C9H4F4S — CID 131029323
3-(difluoromethyl)-5,6-difluoro-1-benzothiophene (PubChem CID 131029323) has the molecular formula C9H4F4S and a molecular weight of 220.19 g/mol. Its IUPAC name is 3-(difluoromethyl)-5,6-difluoro-1-benzothiophene.
| Compound Name | 3-(difluoromethyl)-5,6-difluoro-1-benzothiophene |
|---|---|
| PubChem CID | 131029323 |
| Molecular Formula | C9H4F4S |
| Molecular Weight | 220.19 g/mol |
| Exact Mass | 220.00 |
| IUPAC Name | 3-(difluoromethyl)-5,6-difluoro-1-benzothiophene |
| SMILES | Fc1cc2scc(C(F)F)c2cc1F |
| InChI | InChI=1S/C9H4F4S/c10-6-1-4-5(9(12)13)3-14-8(4)2-7(6)11/h1-3,9H |
| InChIKey | CDYHDPISELZRAB-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.19 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |