About 4-amino-6-(2-chloro-1-methylcyclopropyl)-3-methylsulfanyl-1,2,4-triazin-5-one
4-amino-6-(2-chloro-1-methylcyclopropyl)-3-methylsulfanyl-1,2,4-triazin-5-one (PubChem CID 13103139) has the molecular formula C8H11ClN4OS
and a molecular weight of 246.72 g/mol. Its IUPAC name is 4-amino-6-(2-chloro-1-methylcyclopropyl)-3-methylsulfanyl-1,2,4-triazin-5-one.
Molecular Properties
| Compound Name | 4-amino-6-(2-chloro-1-methylcyclopropyl)-3-methylsulfanyl-1,2,4-triazin-5-one |
| PubChem CID | 13103139 |
| Molecular Formula | C8H11ClN4OS |
| Molecular Weight | 246.72 g/mol |
| Exact Mass | 246.03 |
| IUPAC Name | 4-amino-6-(2-chloro-1-methylcyclopropyl)-3-methylsulfanyl-1,2,4-triazin-5-one |
| SMILES | CSc1nnc(C2(C)CC2Cl)c(=O)n1N |
| InChI | InChI=1S/C8H11ClN4OS/c1-8(3-4(8)9)5-6(14)13(10)7(15-2)12-11-5/h4H,3,10H2,1-2H3 |
| InChIKey | GOYFMVRFXBPFJR-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.72 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-6-(2-chloro-1-methylcyclopropyl)-3-methylsulfanyl-1,2,4-triazin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-6-(2-chloro-1-methylcyclopropyl)-3-methylsulfanyl-1,2,4-triazin-5-one?
The IUPAC name of 4-amino-6-(2-chloro-1-methylcyclopropyl)-3-methylsulfanyl-1,2,4-triazin-5-one (CID 13103139) is 4-amino-6-(2-chloro-1-methylcyclopropyl)-3-methylsulfanyl-1,2,4-triazin-5-one.
What is the SMILES notation for 4-amino-6-(2-chloro-1-methylcyclopropyl)-3-methylsulfanyl-1,2,4-triazin-5-one?
The canonical SMILES for 4-amino-6-(2-chloro-1-methylcyclopropyl)-3-methylsulfanyl-1,2,4-triazin-5-one is CSc1nnc(C2(C)CC2Cl)c(=O)n1N.
What is the InChIKey of 4-amino-6-(2-chloro-1-methylcyclopropyl)-3-methylsulfanyl-1,2,4-triazin-5-one?
The InChIKey is GOYFMVRFXBPFJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11ClN4OS/c1-8(3-4(8)9)5-6(14)13(10)7(15-2)12-11-5/h4H,3,10H2,1-2H3.
What are the key properties of 4-amino-6-(2-chloro-1-methylcyclopropyl)-3-methylsulfanyl-1,2,4-triazin-5-one?
4-amino-6-(2-chloro-1-methylcyclopropyl)-3-methylsulfanyl-1,2,4-triazin-5-one has a molecular weight of 246.72 g/mol, XLogP of 0.34, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-6-(2-chloro-1-methylcyclopropyl)-3-methylsulfanyl-1,2,4-triazin-5-one is sourced from PubChem (CID 13103139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).