C12H21NO2 — CID 131031632
2-[(3-hydroxy-3-methylazetidin-1-yl)methyl]-4-methylcyclohexan-1-one (PubChem CID 131031632) has the molecular formula C12H21NO2 and a molecular weight of 211.30 g/mol. Its IUPAC name is 2-[(3-hydroxy-3-methylazetidin-1-yl)methyl]-4-methylcyclohexan-1-one.
| Compound Name | 2-[(3-hydroxy-3-methylazetidin-1-yl)methyl]-4-methylcyclohexan-1-one |
|---|---|
| PubChem CID | 131031632 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | 2-[(3-hydroxy-3-methylazetidin-1-yl)methyl]-4-methylcyclohexan-1-one |
| SMILES | CC1CCC(=O)C(CN2CC(C)(O)C2)C1 |
| InChI | InChI=1S/C12H21NO2/c1-9-3-4-11(14)10(5-9)6-13-7-12(2,15)8-13/h9-10,15H,3-8H2,1-2H3 |
| InChIKey | MRPOGIRDUBVVLQ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |