C14H15BrN2O5 — CID 1310348
methyl (6S)-6-(3-bromo-4,5-dihydroxyphenyl)-3,4-dimethyl-2-oxo-1,6-dihydropyrimidine-5-carboxylate (PubChem CID 1310348) has the molecular formula C14H15BrN2O5 and a molecular weight of 371.19 g/mol. Its IUPAC name is methyl (6S)-6-(3-bromo-4,5-dihydroxyphenyl)-3,4-dimethyl-2-oxo-1,6-dihydropyrimidine-5-carboxylate.
| Compound Name | methyl (6S)-6-(3-bromo-4,5-dihydroxyphenyl)-3,4-dimethyl-2-oxo-1,6-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 1310348 |
| Molecular Formula | C14H15BrN2O5 |
| Molecular Weight | 371.19 g/mol |
| Exact Mass | 370.02 |
| IUPAC Name | methyl (6S)-6-(3-bromo-4,5-dihydroxyphenyl)-3,4-dimethyl-2-oxo-1,6-dihydropyrimidine-5-carboxylate |
| SMILES | COC(=O)C1=C(C)N(C)C(=O)N[C@H]1c1cc(O)c(O)c(Br)c1 |
| InChI | InChI=1S/C14H15BrN2O5/c1-6-10(13(20)22-3)11(16-14(21)17(6)2)7-4-8(15)12(19)9(18)5-7/h4-5,11,18-19H,1-3H3,(H,16,21)/t11-/m0/s1 |
| InChIKey | RYMRYWIWOHJDGU-NSHDSACASA-N |
| XLogP | 2.00 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.19 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|