About N-(1-cyanocyclopentyl)-2,2-difluoropropanamide
N-(1-cyanocyclopentyl)-2,2-difluoropropanamide (PubChem CID 131036045) has the molecular formula C9H12F2N2O
and a molecular weight of 202.20 g/mol. Its IUPAC name is N-(1-cyanocyclopentyl)-2,2-difluoropropanamide.
Molecular Properties
| Compound Name | N-(1-cyanocyclopentyl)-2,2-difluoropropanamide |
| PubChem CID | 131036045 |
| Molecular Formula | C9H12F2N2O |
| Molecular Weight | 202.20 g/mol |
| Exact Mass | 202.09 |
| IUPAC Name | N-(1-cyanocyclopentyl)-2,2-difluoropropanamide |
| SMILES | CC(F)(F)C(=O)NC1(C#N)CCCC1 |
| InChI | InChI=1S/C9H12F2N2O/c1-8(10,11)7(14)13-9(6-12)4-2-3-5-9/h2-5H2,1H3,(H,13,14) |
| InChIKey | ZMLNNNMMLJGVKF-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.20 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(1-cyanocyclopentyl)-2,2-difluoropropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-cyanocyclopentyl)-2,2-difluoropropanamide?
The IUPAC name of N-(1-cyanocyclopentyl)-2,2-difluoropropanamide (CID 131036045) is N-(1-cyanocyclopentyl)-2,2-difluoropropanamide.
What is the SMILES notation for N-(1-cyanocyclopentyl)-2,2-difluoropropanamide?
The canonical SMILES for N-(1-cyanocyclopentyl)-2,2-difluoropropanamide is CC(F)(F)C(=O)NC1(C#N)CCCC1.
What is the InChIKey of N-(1-cyanocyclopentyl)-2,2-difluoropropanamide?
The InChIKey is ZMLNNNMMLJGVKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12F2N2O/c1-8(10,11)7(14)13-9(6-12)4-2-3-5-9/h2-5H2,1H3,(H,13,14).
What are the key properties of N-(1-cyanocyclopentyl)-2,2-difluoropropanamide?
N-(1-cyanocyclopentyl)-2,2-difluoropropanamide has a molecular weight of 202.20 g/mol, XLogP of 1.59, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-cyanocyclopentyl)-2,2-difluoropropanamide is sourced from PubChem (CID 131036045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).