C9H16N2OS — CID 131036059
2-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]thiazin-4-yl)acetamide (PubChem CID 131036059) has the molecular formula C9H16N2OS and a molecular weight of 200.31 g/mol. Its IUPAC name is 2-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]thiazin-4-yl)acetamide.
| Compound Name | 2-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]thiazin-4-yl)acetamide |
|---|---|
| PubChem CID | 131036059 |
| Molecular Formula | C9H16N2OS |
| Molecular Weight | 200.31 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 2-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]thiazin-4-yl)acetamide |
| SMILES | NC(=O)CN1CCSC2CCCC21 |
| InChI | InChI=1S/C9H16N2OS/c10-9(12)6-11-4-5-13-8-3-1-2-7(8)11/h7-8H,1-6H2,(H2,10,12) |
| InChIKey | QEKPWPHUOSZQNJ-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.31 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |