C8H8BrFN2O — CID 131036089
(3-bromo-4-fluorophenyl)methylurea (PubChem CID 131036089) has the molecular formula C8H8BrFN2O and a molecular weight of 247.07 g/mol. Its IUPAC name is (3-bromo-4-fluorophenyl)methylurea.
| Compound Name | (3-bromo-4-fluorophenyl)methylurea |
|---|---|
| PubChem CID | 131036089 |
| Molecular Formula | C8H8BrFN2O |
| Molecular Weight | 247.07 g/mol |
| Exact Mass | 245.98 |
| IUPAC Name | (3-bromo-4-fluorophenyl)methylurea |
| SMILES | NC(=O)NCc1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C8H8BrFN2O/c9-6-3-5(1-2-7(6)10)4-12-8(11)13/h1-3H,4H2,(H3,11,12,13) |
| InChIKey | SHLOANFDTJUCRU-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.07 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |