C13H20N2S — CID 131036276
N'-benzyl-N'-methyl-N-(thietan-3-yl)ethane-1,2-diamine (PubChem CID 131036276) has the molecular formula C13H20N2S and a molecular weight of 236.38 g/mol. Its IUPAC name is N'-benzyl-N'-methyl-N-(thietan-3-yl)ethane-1,2-diamine.
| Compound Name | N'-benzyl-N'-methyl-N-(thietan-3-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 131036276 |
| Molecular Formula | C13H20N2S |
| Molecular Weight | 236.38 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | N'-benzyl-N'-methyl-N-(thietan-3-yl)ethane-1,2-diamine |
| SMILES | CN(CCNC1CSC1)Cc1ccccc1 |
| InChI | InChI=1S/C13H20N2S/c1-15(8-7-14-13-10-16-11-13)9-12-5-3-2-4-6-12/h2-6,13-14H,7-11H2,1H3 |
| InChIKey | GRSDHONFGGXYCP-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.38 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |