About (3-methoxy-1,2-thiazol-5-yl)methylcyanamide
(3-methoxy-1,2-thiazol-5-yl)methylcyanamide (PubChem CID 131036521) has the molecular formula C6H7N3OS
and a molecular weight of 169.21 g/mol. Its IUPAC name is (3-methoxy-1,2-thiazol-5-yl)methylcyanamide.
Molecular Properties
| Compound Name | (3-methoxy-1,2-thiazol-5-yl)methylcyanamide |
| PubChem CID | 131036521 |
| Molecular Formula | C6H7N3OS |
| Molecular Weight | 169.21 g/mol |
| Exact Mass | 169.03 |
| IUPAC Name | (3-methoxy-1,2-thiazol-5-yl)methylcyanamide |
| SMILES | COc1cc(CNC#N)sn1 |
| InChI | InChI=1S/C6H7N3OS/c1-10-6-2-5(11-9-6)3-8-4-7/h2,8H,3H2,1H3 |
| InChIKey | UPXWUWARNCSVMG-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.21 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|
Analyze (3-methoxy-1,2-thiazol-5-yl)methylcyanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methoxy-1,2-thiazol-5-yl)methylcyanamide?
The IUPAC name of (3-methoxy-1,2-thiazol-5-yl)methylcyanamide (CID 131036521) is (3-methoxy-1,2-thiazol-5-yl)methylcyanamide.
What is the SMILES notation for (3-methoxy-1,2-thiazol-5-yl)methylcyanamide?
The canonical SMILES for (3-methoxy-1,2-thiazol-5-yl)methylcyanamide is COc1cc(CNC#N)sn1.
What is the InChIKey of (3-methoxy-1,2-thiazol-5-yl)methylcyanamide?
The InChIKey is UPXWUWARNCSVMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N3OS/c1-10-6-2-5(11-9-6)3-8-4-7/h2,8H,3H2,1H3.
What are the key properties of (3-methoxy-1,2-thiazol-5-yl)methylcyanamide?
(3-methoxy-1,2-thiazol-5-yl)methylcyanamide has a molecular weight of 169.21 g/mol, XLogP of 0.72, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methoxy-1,2-thiazol-5-yl)methylcyanamide is sourced from PubChem (CID 131036521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).