C7H7F3N2O — CID 131036778
N-[(1R)-2,2,2-trifluoro-1-pyridin-3-ylethyl]hydroxylamine (PubChem CID 131036778) has the molecular formula C7H7F3N2O and a molecular weight of 192.14 g/mol. Its IUPAC name is N-[(1R)-2,2,2-trifluoro-1-pyridin-3-ylethyl]hydroxylamine.
| Compound Name | N-[(1R)-2,2,2-trifluoro-1-pyridin-3-ylethyl]hydroxylamine |
|---|---|
| PubChem CID | 131036778 |
| Molecular Formula | C7H7F3N2O |
| Molecular Weight | 192.14 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | N-[(1R)-2,2,2-trifluoro-1-pyridin-3-ylethyl]hydroxylamine |
| SMILES | ON[C@H](c1cccnc1)C(F)(F)F |
| InChI | InChI=1S/C7H7F3N2O/c8-7(9,10)6(12-13)5-2-1-3-11-4-5/h1-4,6,12-13H/t6-/m1/s1 |
| InChIKey | SUBYKQOJHMJZSC-ZCFIWIBFSA-N |
| XLogP | 1.66 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.14 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|