C12H13NO4S — CID 13103774
5-[(2,3-dimethoxyphenyl)methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 13103774) has the molecular formula C12H13NO4S and a molecular weight of 267.31 g/mol. Its IUPAC name is 5-[(2,3-dimethoxyphenyl)methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[(2,3-dimethoxyphenyl)methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 13103774 |
| Molecular Formula | C12H13NO4S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 5-[(2,3-dimethoxyphenyl)methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1cccc(CC2SC(=O)NC2=O)c1OC |
| InChI | InChI=1S/C12H13NO4S/c1-16-8-5-3-4-7(10(8)17-2)6-9-11(14)13-12(15)18-9/h3-5,9H,6H2,1-2H3,(H,13,14,15) |
| InChIKey | LCGRJWMCEZLUGT-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|