C9H12N2O2S — CID 131037945
(4R)-1,1-dioxo-3,4-dihydro-2H-thiochromene-4,8-diamine (PubChem CID 131037945) has the molecular formula C9H12N2O2S and a molecular weight of 212.27 g/mol. Its IUPAC name is (4R)-1,1-dioxo-3,4-dihydro-2H-thiochromene-4,8-diamine.
| Compound Name | (4R)-1,1-dioxo-3,4-dihydro-2H-thiochromene-4,8-diamine |
|---|---|
| PubChem CID | 131037945 |
| Molecular Formula | C9H12N2O2S |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | (4R)-1,1-dioxo-3,4-dihydro-2H-thiochromene-4,8-diamine |
| SMILES | Nc1cccc2c1S(=O)(=O)CC[C@H]2N |
| InChI | InChI=1S/C9H12N2O2S/c10-7-4-5-14(12,13)9-6(7)2-1-3-8(9)11/h1-3,7H,4-5,10-11H2/t7-/m1/s1 |
| InChIKey | WSAIBHMDXQBZMM-SSDOTTSWSA-N |
| XLogP | 0.45 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|