C13H17N — CID 131037986
2-(cyclopenten-1-yl)-1-phenylethanamine (PubChem CID 131037986) has the molecular formula C13H17N and a molecular weight of 187.29 g/mol. Its IUPAC name is 2-(cyclopenten-1-yl)-1-phenylethanamine.
| Compound Name | 2-(cyclopenten-1-yl)-1-phenylethanamine |
|---|---|
| PubChem CID | 131037986 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | 2-(cyclopenten-1-yl)-1-phenylethanamine |
| SMILES | NC(CC1=CCCC1)c1ccccc1 |
| InChI | InChI=1S/C13H17N/c14-13(10-11-6-4-5-7-11)12-8-2-1-3-9-12/h1-3,6,8-9,13H,4-5,7,10,14H2 |
| InChIKey | MRZDROAHSNVGNQ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|