About 1-(1,3-thiazolidin-3-yl)-2-(1,3-thiazol-5-yl)ethanone
1-(1,3-thiazolidin-3-yl)-2-(1,3-thiazol-5-yl)ethanone (PubChem CID 131038136) has the molecular formula C8H10N2OS2
and a molecular weight of 214.31 g/mol. Its IUPAC name is 1-(1,3-thiazolidin-3-yl)-2-(1,3-thiazol-5-yl)ethanone.
Molecular Properties
| Compound Name | 1-(1,3-thiazolidin-3-yl)-2-(1,3-thiazol-5-yl)ethanone |
| PubChem CID | 131038136 |
| Molecular Formula | C8H10N2OS2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.02 |
| IUPAC Name | 1-(1,3-thiazolidin-3-yl)-2-(1,3-thiazol-5-yl)ethanone |
| SMILES | O=C(Cc1cncs1)N1CCSC1 |
| InChI | InChI=1S/C8H10N2OS2/c11-8(10-1-2-12-6-10)3-7-4-9-5-13-7/h4-5H,1-3,6H2 |
| InChIKey | PHGGYOWRCRYJHJ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(1,3-thiazolidin-3-yl)-2-(1,3-thiazol-5-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,3-thiazolidin-3-yl)-2-(1,3-thiazol-5-yl)ethanone?
The IUPAC name of 1-(1,3-thiazolidin-3-yl)-2-(1,3-thiazol-5-yl)ethanone (CID 131038136) is 1-(1,3-thiazolidin-3-yl)-2-(1,3-thiazol-5-yl)ethanone.
What is the SMILES notation for 1-(1,3-thiazolidin-3-yl)-2-(1,3-thiazol-5-yl)ethanone?
The canonical SMILES for 1-(1,3-thiazolidin-3-yl)-2-(1,3-thiazol-5-yl)ethanone is O=C(Cc1cncs1)N1CCSC1.
What is the InChIKey of 1-(1,3-thiazolidin-3-yl)-2-(1,3-thiazol-5-yl)ethanone?
The InChIKey is PHGGYOWRCRYJHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2OS2/c11-8(10-1-2-12-6-10)3-7-4-9-5-13-7/h4-5H,1-3,6H2.
What are the key properties of 1-(1,3-thiazolidin-3-yl)-2-(1,3-thiazol-5-yl)ethanone?
1-(1,3-thiazolidin-3-yl)-2-(1,3-thiazol-5-yl)ethanone has a molecular weight of 214.31 g/mol, XLogP of 1.22, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,3-thiazolidin-3-yl)-2-(1,3-thiazol-5-yl)ethanone is sourced from PubChem (CID 131038136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).