About 2-chloro-N-(3,3-difluorocyclobutyl)-1,3-thiazol-4-amine
2-chloro-N-(3,3-difluorocyclobutyl)-1,3-thiazol-4-amine (PubChem CID 131038137) has the molecular formula C7H7ClF2N2S
and a molecular weight of 224.66 g/mol. Its IUPAC name is 2-chloro-N-(3,3-difluorocyclobutyl)-1,3-thiazol-4-amine.
Molecular Properties
| Compound Name | 2-chloro-N-(3,3-difluorocyclobutyl)-1,3-thiazol-4-amine |
| PubChem CID | 131038137 |
| Molecular Formula | C7H7ClF2N2S |
| Molecular Weight | 224.66 g/mol |
| Exact Mass | 224.00 |
| IUPAC Name | 2-chloro-N-(3,3-difluorocyclobutyl)-1,3-thiazol-4-amine |
| SMILES | FC1(F)CC(Nc2csc(Cl)n2)C1 |
| InChI | InChI=1S/C7H7ClF2N2S/c8-6-12-5(3-13-6)11-4-1-7(9,10)2-4/h3-4,11H,1-2H2 |
| InChIKey | JFVFNQOSSIVTRL-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.66 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-chloro-N-(3,3-difluorocyclobutyl)-1,3-thiazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-(3,3-difluorocyclobutyl)-1,3-thiazol-4-amine?
The IUPAC name of 2-chloro-N-(3,3-difluorocyclobutyl)-1,3-thiazol-4-amine (CID 131038137) is 2-chloro-N-(3,3-difluorocyclobutyl)-1,3-thiazol-4-amine.
What is the SMILES notation for 2-chloro-N-(3,3-difluorocyclobutyl)-1,3-thiazol-4-amine?
The canonical SMILES for 2-chloro-N-(3,3-difluorocyclobutyl)-1,3-thiazol-4-amine is FC1(F)CC(Nc2csc(Cl)n2)C1.
What is the InChIKey of 2-chloro-N-(3,3-difluorocyclobutyl)-1,3-thiazol-4-amine?
The InChIKey is JFVFNQOSSIVTRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7ClF2N2S/c8-6-12-5(3-13-6)11-4-1-7(9,10)2-4/h3-4,11H,1-2H2.
What are the key properties of 2-chloro-N-(3,3-difluorocyclobutyl)-1,3-thiazol-4-amine?
2-chloro-N-(3,3-difluorocyclobutyl)-1,3-thiazol-4-amine has a molecular weight of 224.66 g/mol, XLogP of 3.01, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-(3,3-difluorocyclobutyl)-1,3-thiazol-4-amine is sourced from PubChem (CID 131038137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).