About 1-amino-N-[[(2S,4S)-4-fluoropyrrolidin-2-yl]methyl]cyclopropane-1-carboxamide;hydrochloride
1-amino-N-[[(2S,4S)-4-fluoropyrrolidin-2-yl]methyl]cyclopropane-1-carboxamide;hydrochloride (PubChem CID 131038227) has the molecular formula C9H17ClFN3O
and a molecular weight of 237.71 g/mol. Its IUPAC name is 1-amino-N-[[(2S,4S)-4-fluoropyrrolidin-2-yl]methyl]cyclopropane-1-carboxamide;hydrochloride.
Molecular Properties
| Compound Name | 1-amino-N-[[(2S,4S)-4-fluoropyrrolidin-2-yl]methyl]cyclopropane-1-carboxamide;hydrochloride |
| PubChem CID | 131038227 |
| Molecular Formula | C9H17ClFN3O |
| Molecular Weight | 237.71 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 1-amino-N-[[(2S,4S)-4-fluoropyrrolidin-2-yl]methyl]cyclopropane-1-carboxamide;hydrochloride |
| SMILES | Cl.NC1(C(=O)NC[C@@H]2C[C@H](F)CN2)CC1 |
| InChI | InChI=1S/C9H16FN3O.ClH/c10-6-3-7(12-4-6)5-13-8(14)9(11)1-2-9;/h6-7,12H,1-5,11H2,(H,13,14);1H/t6-,7-;/m0./s1 |
| InChIKey | XCFZCOKQEPFQAT-LEUCUCNGSA-N |
| XLogP | -0.28 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.71 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-amino-N-[[(2S,4S)-4-fluoropyrrolidin-2-yl]methyl]cyclopropane-1-carboxamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-N-[[(2S,4S)-4-fluoropyrrolidin-2-yl]methyl]cyclopropane-1-carboxamide;hydrochloride?
The IUPAC name of 1-amino-N-[[(2S,4S)-4-fluoropyrrolidin-2-yl]methyl]cyclopropane-1-carboxamide;hydrochloride (CID 131038227) is 1-amino-N-[[(2S,4S)-4-fluoropyrrolidin-2-yl]methyl]cyclopropane-1-carboxamide;hydrochloride.
What is the SMILES notation for 1-amino-N-[[(2S,4S)-4-fluoropyrrolidin-2-yl]methyl]cyclopropane-1-carboxamide;hydrochloride?
The canonical SMILES for 1-amino-N-[[(2S,4S)-4-fluoropyrrolidin-2-yl]methyl]cyclopropane-1-carboxamide;hydrochloride is Cl.NC1(C(=O)NC[C@@H]2C[C@H](F)CN2)CC1.
What is the InChIKey of 1-amino-N-[[(2S,4S)-4-fluoropyrrolidin-2-yl]methyl]cyclopropane-1-carboxamide;hydrochloride?
The InChIKey is XCFZCOKQEPFQAT-LEUCUCNGSA-N. The full InChI is InChI=1S/C9H16FN3O.ClH/c10-6-3-7(12-4-6)5-13-8(14)9(11)1-2-9;/h6-7,12H,1-5,11H2,(H,13,14);1H/t6-,7-;/m0./s1.
What are the key properties of 1-amino-N-[[(2S,4S)-4-fluoropyrrolidin-2-yl]methyl]cyclopropane-1-carboxamide;hydrochloride?
1-amino-N-[[(2S,4S)-4-fluoropyrrolidin-2-yl]methyl]cyclopropane-1-carboxamide;hydrochloride has a molecular weight of 237.71 g/mol, XLogP of -0.28, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-N-[[(2S,4S)-4-fluoropyrrolidin-2-yl]methyl]cyclopropane-1-carboxamide;hydrochloride is sourced from PubChem (CID 131038227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).