C10H15N3O2S — CID 131041447
N-(1,4-dioxaspiro[4.5]decan-8-yl)-1,2,4-thiadiazol-5-amine (PubChem CID 131041447) has the molecular formula C10H15N3O2S and a molecular weight of 241.32 g/mol. Its IUPAC name is N-(1,4-dioxaspiro[4.5]decan-8-yl)-1,2,4-thiadiazol-5-amine.
| Compound Name | N-(1,4-dioxaspiro[4.5]decan-8-yl)-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 131041447 |
| Molecular Formula | C10H15N3O2S |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | N-(1,4-dioxaspiro[4.5]decan-8-yl)-1,2,4-thiadiazol-5-amine |
| SMILES | c1nsc(NC2CCC3(CC2)OCCO3)n1 |
| InChI | InChI=1S/C10H15N3O2S/c1-3-10(14-5-6-15-10)4-2-8(1)13-9-11-7-12-16-9/h7-8H,1-6H2,(H,11,12,13) |
| InChIKey | LFXKAWKPPMKSJT-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |