About N'-[(3,3-dimethylcyclobutyl)methyl]ethanimidamide;hydroiodide
N'-[(3,3-dimethylcyclobutyl)methyl]ethanimidamide;hydroiodide (PubChem CID 131041453) has the molecular formula C9H19IN2
and a molecular weight of 282.17 g/mol. Its IUPAC name is N'-[(3,3-dimethylcyclobutyl)methyl]ethanimidamide;hydroiodide.
Molecular Properties
| Compound Name | N'-[(3,3-dimethylcyclobutyl)methyl]ethanimidamide;hydroiodide |
| PubChem CID | 131041453 |
| Molecular Formula | C9H19IN2 |
| Molecular Weight | 282.17 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | N'-[(3,3-dimethylcyclobutyl)methyl]ethanimidamide;hydroiodide |
| SMILES | C/C(N)=N\CC1CC(C)(C)C1.I |
| InChI | InChI=1S/C9H18N2.HI/c1-7(10)11-6-8-4-9(2,3)5-8;/h8H,4-6H2,1-3H3,(H2,10,11);1H |
| InChIKey | UDRWGYJXOGADSC-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.17 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze N'-[(3,3-dimethylcyclobutyl)methyl]ethanimidamide;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(3,3-dimethylcyclobutyl)methyl]ethanimidamide;hydroiodide?
The IUPAC name of N'-[(3,3-dimethylcyclobutyl)methyl]ethanimidamide;hydroiodide (CID 131041453) is N'-[(3,3-dimethylcyclobutyl)methyl]ethanimidamide;hydroiodide.
What is the SMILES notation for N'-[(3,3-dimethylcyclobutyl)methyl]ethanimidamide;hydroiodide?
The canonical SMILES for N'-[(3,3-dimethylcyclobutyl)methyl]ethanimidamide;hydroiodide is C/C(N)=N\CC1CC(C)(C)C1.I.
What is the InChIKey of N'-[(3,3-dimethylcyclobutyl)methyl]ethanimidamide;hydroiodide?
The InChIKey is UDRWGYJXOGADSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2.HI/c1-7(10)11-6-8-4-9(2,3)5-8;/h8H,4-6H2,1-3H3,(H2,10,11);1H.
What are the key properties of N'-[(3,3-dimethylcyclobutyl)methyl]ethanimidamide;hydroiodide?
N'-[(3,3-dimethylcyclobutyl)methyl]ethanimidamide;hydroiodide has a molecular weight of 282.17 g/mol, XLogP of 2.42, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(3,3-dimethylcyclobutyl)methyl]ethanimidamide;hydroiodide is sourced from PubChem (CID 131041453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).