C10H5BrFNOS — CID 131042866
(2-bromo-3-fluorophenyl)-(1,2-thiazol-3-yl)methanone (PubChem CID 131042866) has the molecular formula C10H5BrFNOS and a molecular weight of 286.12 g/mol. Its IUPAC name is (2-bromo-3-fluorophenyl)-(1,2-thiazol-3-yl)methanone.
| Compound Name | (2-bromo-3-fluorophenyl)-(1,2-thiazol-3-yl)methanone |
|---|---|
| PubChem CID | 131042866 |
| Molecular Formula | C10H5BrFNOS |
| Molecular Weight | 286.12 g/mol |
| Exact Mass | 284.93 |
| IUPAC Name | (2-bromo-3-fluorophenyl)-(1,2-thiazol-3-yl)methanone |
| SMILES | O=C(c1ccsn1)c1cccc(F)c1Br |
| InChI | InChI=1S/C10H5BrFNOS/c11-9-6(2-1-3-7(9)12)10(14)8-4-5-15-13-8/h1-5H |
| InChIKey | PBGGJAZUAJHCIJ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.12 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |