C9H16ClF3N2 — CID 131043305
(3aS,6aR)-2-(2,2,2-trifluoroethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine;hydrochloride (PubChem CID 131043305) has the molecular formula C9H16ClF3N2 and a molecular weight of 244.69 g/mol. Its IUPAC name is (3aS,6aR)-2-(2,2,2-trifluoroethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine;hydrochloride.
| Compound Name | (3aS,6aR)-2-(2,2,2-trifluoroethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine;hydrochloride |
|---|---|
| PubChem CID | 131043305 |
| Molecular Formula | C9H16ClF3N2 |
| Molecular Weight | 244.69 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | (3aS,6aR)-2-(2,2,2-trifluoroethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine;hydrochloride |
| SMILES | Cl.NC1CC[C@H]2CN(CC(F)(F)F)C[C@@H]12 |
| InChI | InChI=1S/C9H15F3N2.ClH/c10-9(11,12)5-14-3-6-1-2-8(13)7(6)4-14;/h6-8H,1-5,13H2;1H/t6-,7+,8?;/m0./s1 |
| InChIKey | VGZKERGLXRINEP-GZVYQWMRSA-N |
| XLogP | 1.64 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.69 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |