C9H16N2O2S — CID 131043404
6-methylsulfinyl-1,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-2-one (PubChem CID 131043404) has the molecular formula C9H16N2O2S and a molecular weight of 216.31 g/mol. Its IUPAC name is 6-methylsulfinyl-1,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-2-one.
| Compound Name | 6-methylsulfinyl-1,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 131043404 |
| Molecular Formula | C9H16N2O2S |
| Molecular Weight | 216.31 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 6-methylsulfinyl-1,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-2-one |
| SMILES | CS(=O)N1CCC2NC(=O)CCC2C1 |
| InChI | InChI=1S/C9H16N2O2S/c1-14(13)11-5-4-8-7(6-11)2-3-9(12)10-8/h7-8H,2-6H2,1H3,(H,10,12) |
| InChIKey | SDKQZVVDORCAKQ-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.31 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |