About (2R,3S)-2-phenyloxan-3-amine
(2R,3S)-2-phenyloxan-3-amine (PubChem CID 131044940) has the molecular formula C11H15NO
and a molecular weight of 177.25 g/mol. Its IUPAC name is (2R,3S)-2-phenyloxan-3-amine.
Molecular Properties
| Compound Name | (2R,3S)-2-phenyloxan-3-amine |
| PubChem CID | 131044940 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | (2R,3S)-2-phenyloxan-3-amine |
| SMILES | N[C@H]1CCCO[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C11H15NO/c12-10-7-4-8-13-11(10)9-5-2-1-3-6-9/h1-3,5-6,10-11H,4,7-8,12H2/t10-,11+/m0/s1 |
| InChIKey | MKVQAWAZBSCPFQ-WDEREUQCSA-N |
| XLogP | 1.87 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R,3S)-2-phenyloxan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3S)-2-phenyloxan-3-amine?
The IUPAC name of (2R,3S)-2-phenyloxan-3-amine (CID 131044940) is (2R,3S)-2-phenyloxan-3-amine.
What is the SMILES notation for (2R,3S)-2-phenyloxan-3-amine?
The canonical SMILES for (2R,3S)-2-phenyloxan-3-amine is N[C@H]1CCCO[C@@H]1c1ccccc1.
What is the InChIKey of (2R,3S)-2-phenyloxan-3-amine?
The InChIKey is MKVQAWAZBSCPFQ-WDEREUQCSA-N. The full InChI is InChI=1S/C11H15NO/c12-10-7-4-8-13-11(10)9-5-2-1-3-6-9/h1-3,5-6,10-11H,4,7-8,12H2/t10-,11+/m0/s1.
What are the key properties of (2R,3S)-2-phenyloxan-3-amine?
(2R,3S)-2-phenyloxan-3-amine has a molecular weight of 177.25 g/mol, XLogP of 1.87, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3S)-2-phenyloxan-3-amine is sourced from PubChem (CID 131044940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).