C8H6BrN3O2 — CID 131047841
2-(5-bromofuran-2-yl)-1-(1H-1,2,4-triazol-5-yl)ethanone (PubChem CID 131047841) has the molecular formula C8H6BrN3O2 and a molecular weight of 256.06 g/mol. Its IUPAC name is 2-(5-bromofuran-2-yl)-1-(1H-1,2,4-triazol-5-yl)ethanone.
| Compound Name | 2-(5-bromofuran-2-yl)-1-(1H-1,2,4-triazol-5-yl)ethanone |
|---|---|
| PubChem CID | 131047841 |
| Molecular Formula | C8H6BrN3O2 |
| Molecular Weight | 256.06 g/mol |
| Exact Mass | 254.96 |
| IUPAC Name | 2-(5-bromofuran-2-yl)-1-(1H-1,2,4-triazol-5-yl)ethanone |
| SMILES | O=C(Cc1ccc(Br)o1)c1ncn[nH]1 |
| InChI | InChI=1S/C8H6BrN3O2/c9-7-2-1-5(14-7)3-6(13)8-10-4-11-12-8/h1-2,4H,3H2,(H,10,11,12) |
| InChIKey | KGIZNFNVYZGYSN-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.06 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |