C12H19NO — CID 131048662
(3S)-3-amino-3-(3,5-dimethylphenyl)butan-1-ol (PubChem CID 131048662) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is (3S)-3-amino-3-(3,5-dimethylphenyl)butan-1-ol.
| Compound Name | (3S)-3-amino-3-(3,5-dimethylphenyl)butan-1-ol |
|---|---|
| PubChem CID | 131048662 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | (3S)-3-amino-3-(3,5-dimethylphenyl)butan-1-ol |
| SMILES | Cc1cc(C)cc([C@@](C)(N)CCO)c1 |
| InChI | InChI=1S/C12H19NO/c1-9-6-10(2)8-11(7-9)12(3,13)4-5-14/h6-8,14H,4-5,13H2,1-3H3/t12-/m0/s1 |
| InChIKey | QQGHLMXPHCTUIR-LBPRGKRZSA-N |
| XLogP | 1.86 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |