C10H16ClN3 — CID 131049185
1-(6-chloro-3-pyridinyl)-3-methylbutane-1,2-diamine (PubChem CID 131049185) has the molecular formula C10H16ClN3 and a molecular weight of 213.71 g/mol. Its IUPAC name is 1-(6-chloro-3-pyridinyl)-3-methylbutane-1,2-diamine.
| Compound Name | 1-(6-chloro-3-pyridinyl)-3-methylbutane-1,2-diamine |
|---|---|
| PubChem CID | 131049185 |
| Molecular Formula | C10H16ClN3 |
| Molecular Weight | 213.71 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 1-(6-chloro-3-pyridinyl)-3-methylbutane-1,2-diamine |
| SMILES | CC(C)C(N)C(N)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C10H16ClN3/c1-6(2)9(12)10(13)7-3-4-8(11)14-5-7/h3-6,9-10H,12-13H2,1-2H3 |
| InChIKey | PGHJWHYTXVZKJN-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.71 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|