C25H42O3 — CID 13105202
2-[5-hydroxy-2-(3-methoxypropyl)cyclohexyl]-5-(2-methyloctan-2-yl)phenol (PubChem CID 13105202) has the molecular formula C25H42O3 and a molecular weight of 390.61 g/mol. Its IUPAC name is 2-[5-hydroxy-2-(3-methoxypropyl)cyclohexyl]-5-(2-methyloctan-2-yl)phenol.
| Compound Name | 2-[5-hydroxy-2-(3-methoxypropyl)cyclohexyl]-5-(2-methyloctan-2-yl)phenol |
|---|---|
| PubChem CID | 13105202 |
| Molecular Formula | C25H42O3 |
| Molecular Weight | 390.61 g/mol |
| Exact Mass | 390.31 |
| IUPAC Name | 2-[5-hydroxy-2-(3-methoxypropyl)cyclohexyl]-5-(2-methyloctan-2-yl)phenol |
| SMILES | CCCCCCC(C)(C)c1ccc(C2CC(O)CCC2CCCOC)c(O)c1 |
| InChI | InChI=1S/C25H42O3/c1-5-6-7-8-15-25(2,3)20-12-14-22(24(27)17-20)23-18-21(26)13-11-19(23)10-9-16-28-4/h12,14,17,19,21,23,26-27H,5-11,13,15-16,18H2,1-4H3 |
| InChIKey | MOPFZHMTANDERQ-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.61 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|