C32H46O2 — CID 13105210
(1R,3R,4S)-3-[4-(2-methyloctan-2-yl)-2-phenylmethoxyphenyl]-4-prop-2-enylcycloheptan-1-ol (PubChem CID 13105210) has the molecular formula C32H46O2 and a molecular weight of 462.72 g/mol. Its IUPAC name is (1R,3R,4S)-3-[4-(2-methyloctan-2-yl)-2-phenylmethoxyphenyl]-4-prop-2-enylcycloheptan-1-ol.
| Compound Name | (1R,3R,4S)-3-[4-(2-methyloctan-2-yl)-2-phenylmethoxyphenyl]-4-prop-2-enylcycloheptan-1-ol |
|---|---|
| PubChem CID | 13105210 |
| Molecular Formula | C32H46O2 |
| Molecular Weight | 462.72 g/mol |
| Exact Mass | 462.35 |
| IUPAC Name | (1R,3R,4S)-3-[4-(2-methyloctan-2-yl)-2-phenylmethoxyphenyl]-4-prop-2-enylcycloheptan-1-ol |
| SMILES | C=CC[C@@H]1CCC[C@@H](O)C[C@H]1c1ccc(C(C)(C)CCCCCC)cc1OCc1ccccc1 |
| InChI | InChI=1S/C32H46O2/c1-5-7-8-12-21-32(3,4)27-19-20-29(30-23-28(33)18-13-17-26(30)14-6-2)31(22-27)34-24-25-15-10-9-11-16-25/h6,9-11,15-16,19-20,22,26,28,30,33H,2,5,7-8,12-14,17-18,21,23-24H2,1,3-4H3/t26-,28-,30-/m1/s1 |
| InChIKey | JYZRXSXGHNORNZ-YQKLYGQBSA-N |
| XLogP | 8.72 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.72 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|