C9H18N2 — CID 131052863
4-ethyl-1,4-diazabicyclo[3.3.1]nonane (PubChem CID 131052863) has the molecular formula C9H18N2 and a molecular weight of 154.26 g/mol. Its IUPAC name is 4-ethyl-1,4-diazabicyclo[3.3.1]nonane.
| Compound Name | 4-ethyl-1,4-diazabicyclo[3.3.1]nonane |
|---|---|
| PubChem CID | 131052863 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | 4-ethyl-1,4-diazabicyclo[3.3.1]nonane |
| SMILES | CCN1CCN2CCCC1C2 |
| InChI | InChI=1S/C9H18N2/c1-2-11-7-6-10-5-3-4-9(11)8-10/h9H,2-8H2,1H3 |
| InChIKey | CKDCIBVHOFOTFN-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |