C12H11NS — CID 131053362
2-(5,6-dimethyl-1-benzothiophen-3-yl)acetonitrile (PubChem CID 131053362) has the molecular formula C12H11NS and a molecular weight of 201.29 g/mol. Its IUPAC name is 2-(5,6-dimethyl-1-benzothiophen-3-yl)acetonitrile.
| Compound Name | 2-(5,6-dimethyl-1-benzothiophen-3-yl)acetonitrile |
|---|---|
| PubChem CID | 131053362 |
| Molecular Formula | C12H11NS |
| Molecular Weight | 201.29 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | 2-(5,6-dimethyl-1-benzothiophen-3-yl)acetonitrile |
| SMILES | Cc1cc2scc(CC#N)c2cc1C |
| InChI | InChI=1S/C12H11NS/c1-8-5-11-10(3-4-13)7-14-12(11)6-9(8)2/h5-7H,3H2,1-2H3 |
| InChIKey | YXNPIKLUPRNMRU-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.29 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |