About 5-bromo-3,6-dichloro-1-benzothiophene
5-bromo-3,6-dichloro-1-benzothiophene (PubChem CID 131053565) has the molecular formula C8H3BrCl2S
and a molecular weight of 281.99 g/mol. Its IUPAC name is 5-bromo-3,6-dichloro-1-benzothiophene.
Molecular Properties
| Compound Name | 5-bromo-3,6-dichloro-1-benzothiophene |
| PubChem CID | 131053565 |
| Molecular Formula | C8H3BrCl2S |
| Molecular Weight | 281.99 g/mol |
| Exact Mass | 279.85 |
| IUPAC Name | 5-bromo-3,6-dichloro-1-benzothiophene |
| SMILES | Clc1cc2scc(Cl)c2cc1Br |
| InChI | InChI=1S/C8H3BrCl2S/c9-5-1-4-7(11)3-12-8(4)2-6(5)10/h1-3H |
| InChIKey | ALMOAXCGEMJOGD-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.99 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-bromo-3,6-dichloro-1-benzothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-3,6-dichloro-1-benzothiophene?
The IUPAC name of 5-bromo-3,6-dichloro-1-benzothiophene (CID 131053565) is 5-bromo-3,6-dichloro-1-benzothiophene.
What is the SMILES notation for 5-bromo-3,6-dichloro-1-benzothiophene?
The canonical SMILES for 5-bromo-3,6-dichloro-1-benzothiophene is Clc1cc2scc(Cl)c2cc1Br.
What is the InChIKey of 5-bromo-3,6-dichloro-1-benzothiophene?
The InChIKey is ALMOAXCGEMJOGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H3BrCl2S/c9-5-1-4-7(11)3-12-8(4)2-6(5)10/h1-3H.
What are the key properties of 5-bromo-3,6-dichloro-1-benzothiophene?
5-bromo-3,6-dichloro-1-benzothiophene has a molecular weight of 281.99 g/mol, XLogP of 4.97, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-3,6-dichloro-1-benzothiophene is sourced from PubChem (CID 131053565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).