C9H19N3O2 — CID 131054195
2-[2-(aminomethyl)-1,4-oxazepan-4-yl]-N-methylacetamide (PubChem CID 131054195) has the molecular formula C9H19N3O2 and a molecular weight of 201.27 g/mol. Its IUPAC name is 2-[2-(aminomethyl)-1,4-oxazepan-4-yl]-N-methylacetamide.
| Compound Name | 2-[2-(aminomethyl)-1,4-oxazepan-4-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 131054195 |
| Molecular Formula | C9H19N3O2 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 2-[2-(aminomethyl)-1,4-oxazepan-4-yl]-N-methylacetamide |
| SMILES | CNC(=O)CN1CCCOC(CN)C1 |
| InChI | InChI=1S/C9H19N3O2/c1-11-9(13)7-12-3-2-4-14-8(5-10)6-12/h8H,2-7,10H2,1H3,(H,11,13) |
| InChIKey | NQIUTSXXHQTUIA-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |