About N-tert-butylsulfonyl-2,2-difluoroacetamide
N-tert-butylsulfonyl-2,2-difluoroacetamide (PubChem CID 131057085) has the molecular formula C6H11F2NO3S
and a molecular weight of 215.22 g/mol. Its IUPAC name is N-tert-butylsulfonyl-2,2-difluoroacetamide.
Molecular Properties
| Compound Name | N-tert-butylsulfonyl-2,2-difluoroacetamide |
| PubChem CID | 131057085 |
| Molecular Formula | C6H11F2NO3S |
| Molecular Weight | 215.22 g/mol |
| Exact Mass | 215.04 |
| IUPAC Name | N-tert-butylsulfonyl-2,2-difluoroacetamide |
| SMILES | CC(C)(C)S(=O)(=O)NC(=O)C(F)F |
| InChI | InChI=1S/C6H11F2NO3S/c1-6(2,3)13(11,12)9-5(10)4(7)8/h4H,1-3H3,(H,9,10) |
| InChIKey | LUQBWKMYUCQNFU-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.22 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-tert-butylsulfonyl-2,2-difluoroacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butylsulfonyl-2,2-difluoroacetamide?
The IUPAC name of N-tert-butylsulfonyl-2,2-difluoroacetamide (CID 131057085) is N-tert-butylsulfonyl-2,2-difluoroacetamide.
What is the SMILES notation for N-tert-butylsulfonyl-2,2-difluoroacetamide?
The canonical SMILES for N-tert-butylsulfonyl-2,2-difluoroacetamide is CC(C)(C)S(=O)(=O)NC(=O)C(F)F.
What is the InChIKey of N-tert-butylsulfonyl-2,2-difluoroacetamide?
The InChIKey is LUQBWKMYUCQNFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11F2NO3S/c1-6(2,3)13(11,12)9-5(10)4(7)8/h4H,1-3H3,(H,9,10).
What are the key properties of N-tert-butylsulfonyl-2,2-difluoroacetamide?
N-tert-butylsulfonyl-2,2-difluoroacetamide has a molecular weight of 215.22 g/mol, XLogP of 0.50, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butylsulfonyl-2,2-difluoroacetamide is sourced from PubChem (CID 131057085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).