C11H18O — CID 131057193
(3aS,8aR)-3a-methyl-1,2,3,5,6,7,8,8a-octahydroazulen-4-one (PubChem CID 131057193) has the molecular formula C11H18O and a molecular weight of 166.26 g/mol. Its IUPAC name is (3aS,8aR)-3a-methyl-1,2,3,5,6,7,8,8a-octahydroazulen-4-one.
| Compound Name | (3aS,8aR)-3a-methyl-1,2,3,5,6,7,8,8a-octahydroazulen-4-one |
|---|---|
| PubChem CID | 131057193 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | (3aS,8aR)-3a-methyl-1,2,3,5,6,7,8,8a-octahydroazulen-4-one |
| SMILES | C[C@]12CCC[C@H]1CCCCC2=O |
| InChI | InChI=1S/C11H18O/c1-11-8-4-6-9(11)5-2-3-7-10(11)12/h9H,2-8H2,1H3/t9-,11+/m1/s1 |
| InChIKey | LPDMHSMXAWSDBI-KOLCDFICSA-N |
| XLogP | 2.94 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |