C5H9BrO3 — CID 131057500
(2R,4S,5S)-5-(bromomethyl)oxolane-2,4-diol (PubChem CID 131057500) has the molecular formula C5H9BrO3 and a molecular weight of 197.03 g/mol. Its IUPAC name is (2R,4S,5S)-5-(bromomethyl)oxolane-2,4-diol.
| Compound Name | (2R,4S,5S)-5-(bromomethyl)oxolane-2,4-diol |
|---|---|
| PubChem CID | 131057500 |
| Molecular Formula | C5H9BrO3 |
| Molecular Weight | 197.03 g/mol |
| Exact Mass | 195.97 |
| IUPAC Name | (2R,4S,5S)-5-(bromomethyl)oxolane-2,4-diol |
| SMILES | O[C@H]1C[C@H](O)[C@@H](CBr)O1 |
| InChI | InChI=1S/C5H9BrO3/c6-2-4-3(7)1-5(8)9-4/h3-5,7-8H,1-2H2/t3-,4+,5+/m0/s1 |
| InChIKey | BSJNYMYDEYTUOO-VPENINKCSA-N |
| XLogP | -0.15 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.03 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|