C7H11ClN2O — CID 131059514
1-(5-chlorofuran-2-yl)propane-1,2-diamine (PubChem CID 131059514) has the molecular formula C7H11ClN2O and a molecular weight of 174.63 g/mol. Its IUPAC name is 1-(5-chlorofuran-2-yl)propane-1,2-diamine.
| Compound Name | 1-(5-chlorofuran-2-yl)propane-1,2-diamine |
|---|---|
| PubChem CID | 131059514 |
| Molecular Formula | C7H11ClN2O |
| Molecular Weight | 174.63 g/mol |
| Exact Mass | 174.06 |
| IUPAC Name | 1-(5-chlorofuran-2-yl)propane-1,2-diamine |
| SMILES | CC(N)C(N)c1ccc(Cl)o1 |
| InChI | InChI=1S/C7H11ClN2O/c1-4(9)7(10)5-2-3-6(8)11-5/h2-4,7H,9-10H2,1H3 |
| InChIKey | JSWXZXHMEAUADD-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.63 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |