About 2-[[(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]methyl]-3-methylbutanenitrile
2-[[(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]methyl]-3-methylbutanenitrile (PubChem CID 131060245) has the molecular formula C10H18N2O2
and a molecular weight of 198.27 g/mol. Its IUPAC name is 2-[[(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]methyl]-3-methylbutanenitrile.
Molecular Properties
| Compound Name | 2-[[(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]methyl]-3-methylbutanenitrile |
| PubChem CID | 131060245 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 2-[[(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]methyl]-3-methylbutanenitrile |
| SMILES | CC(C)C(C#N)CN1C[C@@H](O)[C@@H](O)C1 |
| InChI | InChI=1S/C10H18N2O2/c1-7(2)8(3-11)4-12-5-9(13)10(14)6-12/h7-10,13-14H,4-6H2,1-2H3/t8?,9-,10+ |
| InChIKey | NFOWOFDNGKRTDJ-PBINXNQUSA-N |
| XLogP | -0.18 |
| TPSA | 67.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[[(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]methyl]-3-methylbutanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]methyl]-3-methylbutanenitrile?
The IUPAC name of 2-[[(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]methyl]-3-methylbutanenitrile (CID 131060245) is 2-[[(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]methyl]-3-methylbutanenitrile.
What is the SMILES notation for 2-[[(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]methyl]-3-methylbutanenitrile?
The canonical SMILES for 2-[[(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]methyl]-3-methylbutanenitrile is CC(C)C(C#N)CN1C[C@@H](O)[C@@H](O)C1.
What is the InChIKey of 2-[[(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]methyl]-3-methylbutanenitrile?
The InChIKey is NFOWOFDNGKRTDJ-PBINXNQUSA-N. The full InChI is InChI=1S/C10H18N2O2/c1-7(2)8(3-11)4-12-5-9(13)10(14)6-12/h7-10,13-14H,4-6H2,1-2H3/t8?,9-,10+.
What are the key properties of 2-[[(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]methyl]-3-methylbutanenitrile?
2-[[(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]methyl]-3-methylbutanenitrile has a molecular weight of 198.27 g/mol, XLogP of -0.18, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]methyl]-3-methylbutanenitrile is sourced from PubChem (CID 131060245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).