About N'-ethyl-3,7-dioxa-9-azabicyclo[3.3.1]nonane-9-carboximidamide
N'-ethyl-3,7-dioxa-9-azabicyclo[3.3.1]nonane-9-carboximidamide (PubChem CID 131062553) has the molecular formula C9H17N3O2
and a molecular weight of 199.25 g/mol. Its IUPAC name is N'-ethyl-3,7-dioxa-9-azabicyclo[3.3.1]nonane-9-carboximidamide.
Molecular Properties
| Compound Name | N'-ethyl-3,7-dioxa-9-azabicyclo[3.3.1]nonane-9-carboximidamide |
| PubChem CID | 131062553 |
| Molecular Formula | C9H17N3O2 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.13 |
| IUPAC Name | N'-ethyl-3,7-dioxa-9-azabicyclo[3.3.1]nonane-9-carboximidamide |
| SMILES | CC/N=C(\N)N1C2COCC1COC2 |
| InChI | InChI=1S/C9H17N3O2/c1-2-11-9(10)12-7-3-13-5-8(12)6-14-4-7/h7-8H,2-6H2,1H3,(H2,10,11) |
| InChIKey | SJFOEXIZIFVOTQ-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 60.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-ethyl-3,7-dioxa-9-azabicyclo[3.3.1]nonane-9-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-ethyl-3,7-dioxa-9-azabicyclo[3.3.1]nonane-9-carboximidamide?
The IUPAC name of N'-ethyl-3,7-dioxa-9-azabicyclo[3.3.1]nonane-9-carboximidamide (CID 131062553) is N'-ethyl-3,7-dioxa-9-azabicyclo[3.3.1]nonane-9-carboximidamide.
What is the SMILES notation for N'-ethyl-3,7-dioxa-9-azabicyclo[3.3.1]nonane-9-carboximidamide?
The canonical SMILES for N'-ethyl-3,7-dioxa-9-azabicyclo[3.3.1]nonane-9-carboximidamide is CC/N=C(\N)N1C2COCC1COC2.
What is the InChIKey of N'-ethyl-3,7-dioxa-9-azabicyclo[3.3.1]nonane-9-carboximidamide?
The InChIKey is SJFOEXIZIFVOTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3O2/c1-2-11-9(10)12-7-3-13-5-8(12)6-14-4-7/h7-8H,2-6H2,1H3,(H2,10,11).
What are the key properties of N'-ethyl-3,7-dioxa-9-azabicyclo[3.3.1]nonane-9-carboximidamide?
N'-ethyl-3,7-dioxa-9-azabicyclo[3.3.1]nonane-9-carboximidamide has a molecular weight of 199.25 g/mol, XLogP of -0.58, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-ethyl-3,7-dioxa-9-azabicyclo[3.3.1]nonane-9-carboximidamide is sourced from PubChem (CID 131062553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).