C9H12O3 — CID 131064467
1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]buta-2,3-dien-1-one (PubChem CID 131064467) has the molecular formula C9H12O3 and a molecular weight of 168.19 g/mol. Its IUPAC name is 1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]buta-2,3-dien-1-one.
| Compound Name | 1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]buta-2,3-dien-1-one |
|---|---|
| PubChem CID | 131064467 |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | 1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]buta-2,3-dien-1-one |
| SMILES | C=C=CC(=O)[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C9H12O3/c1-4-5-7(10)8-6-11-9(2,3)12-8/h5,8H,1,6H2,2-3H3/t8-/m0/s1 |
| InChIKey | KRIHSGJLZAIPKA-QMMMGPOBSA-N |
| XLogP | 1.05 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|