About 7-methyl-4-(3-methylbut-3-enyl)-1,4-thiazepane
7-methyl-4-(3-methylbut-3-enyl)-1,4-thiazepane (PubChem CID 131065136) has the molecular formula C11H21NS
and a molecular weight of 199.36 g/mol. Its IUPAC name is 7-methyl-4-(3-methylbut-3-enyl)-1,4-thiazepane.
Molecular Properties
| Compound Name | 7-methyl-4-(3-methylbut-3-enyl)-1,4-thiazepane |
| PubChem CID | 131065136 |
| Molecular Formula | C11H21NS |
| Molecular Weight | 199.36 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | 7-methyl-4-(3-methylbut-3-enyl)-1,4-thiazepane |
| SMILES | C=C(C)CCN1CCSC(C)CC1 |
| InChI | InChI=1S/C11H21NS/c1-10(2)4-6-12-7-5-11(3)13-9-8-12/h11H,1,4-9H2,2-3H3 |
| InChIKey | DGBWVGYPRSGHFZ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.36 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 7-methyl-4-(3-methylbut-3-enyl)-1,4-thiazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-4-(3-methylbut-3-enyl)-1,4-thiazepane?
The IUPAC name of 7-methyl-4-(3-methylbut-3-enyl)-1,4-thiazepane (CID 131065136) is 7-methyl-4-(3-methylbut-3-enyl)-1,4-thiazepane.
What is the SMILES notation for 7-methyl-4-(3-methylbut-3-enyl)-1,4-thiazepane?
The canonical SMILES for 7-methyl-4-(3-methylbut-3-enyl)-1,4-thiazepane is C=C(C)CCN1CCSC(C)CC1.
What is the InChIKey of 7-methyl-4-(3-methylbut-3-enyl)-1,4-thiazepane?
The InChIKey is DGBWVGYPRSGHFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NS/c1-10(2)4-6-12-7-5-11(3)13-9-8-12/h11H,1,4-9H2,2-3H3.
What are the key properties of 7-methyl-4-(3-methylbut-3-enyl)-1,4-thiazepane?
7-methyl-4-(3-methylbut-3-enyl)-1,4-thiazepane has a molecular weight of 199.36 g/mol, XLogP of 2.78, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-4-(3-methylbut-3-enyl)-1,4-thiazepane is sourced from PubChem (CID 131065136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).