About methyl N-(3-propyl-1,2,4-thiadiazol-5-yl)carbamate
methyl N-(3-propyl-1,2,4-thiadiazol-5-yl)carbamate (PubChem CID 131065153) has the molecular formula C7H11N3O2S
and a molecular weight of 201.25 g/mol. Its IUPAC name is methyl N-(3-propyl-1,2,4-thiadiazol-5-yl)carbamate.
Molecular Properties
| Compound Name | methyl N-(3-propyl-1,2,4-thiadiazol-5-yl)carbamate |
| PubChem CID | 131065153 |
| Molecular Formula | C7H11N3O2S |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | methyl N-(3-propyl-1,2,4-thiadiazol-5-yl)carbamate |
| SMILES | CCCc1nsc(NC(=O)OC)n1 |
| InChI | InChI=1S/C7H11N3O2S/c1-3-4-5-8-6(13-10-5)9-7(11)12-2/h3-4H2,1-2H3,(H,8,9,10,11) |
| InChIKey | QYBLQVIUAUFCMK-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl N-(3-propyl-1,2,4-thiadiazol-5-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-(3-propyl-1,2,4-thiadiazol-5-yl)carbamate?
The IUPAC name of methyl N-(3-propyl-1,2,4-thiadiazol-5-yl)carbamate (CID 131065153) is methyl N-(3-propyl-1,2,4-thiadiazol-5-yl)carbamate.
What is the SMILES notation for methyl N-(3-propyl-1,2,4-thiadiazol-5-yl)carbamate?
The canonical SMILES for methyl N-(3-propyl-1,2,4-thiadiazol-5-yl)carbamate is CCCc1nsc(NC(=O)OC)n1.
What is the InChIKey of methyl N-(3-propyl-1,2,4-thiadiazol-5-yl)carbamate?
The InChIKey is QYBLQVIUAUFCMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3O2S/c1-3-4-5-8-6(13-10-5)9-7(11)12-2/h3-4H2,1-2H3,(H,8,9,10,11).
What are the key properties of methyl N-(3-propyl-1,2,4-thiadiazol-5-yl)carbamate?
methyl N-(3-propyl-1,2,4-thiadiazol-5-yl)carbamate has a molecular weight of 201.25 g/mol, XLogP of 1.67, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-(3-propyl-1,2,4-thiadiazol-5-yl)carbamate is sourced from PubChem (CID 131065153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).