About 2-cyclopropyl-N-methoxy-1,3-oxazole-4-carboxamide
2-cyclopropyl-N-methoxy-1,3-oxazole-4-carboxamide (PubChem CID 131065219) has the molecular formula C8H10N2O3
and a molecular weight of 182.18 g/mol. Its IUPAC name is 2-cyclopropyl-N-methoxy-1,3-oxazole-4-carboxamide.
Molecular Properties
| Compound Name | 2-cyclopropyl-N-methoxy-1,3-oxazole-4-carboxamide |
| PubChem CID | 131065219 |
| Molecular Formula | C8H10N2O3 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | 2-cyclopropyl-N-methoxy-1,3-oxazole-4-carboxamide |
| SMILES | CONC(=O)c1coc(C2CC2)n1 |
| InChI | InChI=1S/C8H10N2O3/c1-12-10-7(11)6-4-13-8(9-6)5-2-3-5/h4-5H,2-3H2,1H3,(H,10,11) |
| InChIKey | BRPHYSDISDLXAD-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclopropyl-N-methoxy-1,3-oxazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-N-methoxy-1,3-oxazole-4-carboxamide?
The IUPAC name of 2-cyclopropyl-N-methoxy-1,3-oxazole-4-carboxamide (CID 131065219) is 2-cyclopropyl-N-methoxy-1,3-oxazole-4-carboxamide.
What is the SMILES notation for 2-cyclopropyl-N-methoxy-1,3-oxazole-4-carboxamide?
The canonical SMILES for 2-cyclopropyl-N-methoxy-1,3-oxazole-4-carboxamide is CONC(=O)c1coc(C2CC2)n1.
What is the InChIKey of 2-cyclopropyl-N-methoxy-1,3-oxazole-4-carboxamide?
The InChIKey is BRPHYSDISDLXAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O3/c1-12-10-7(11)6-4-13-8(9-6)5-2-3-5/h4-5H,2-3H2,1H3,(H,10,11).
What are the key properties of 2-cyclopropyl-N-methoxy-1,3-oxazole-4-carboxamide?
2-cyclopropyl-N-methoxy-1,3-oxazole-4-carboxamide has a molecular weight of 182.18 g/mol, XLogP of 0.84, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-N-methoxy-1,3-oxazole-4-carboxamide is sourced from PubChem (CID 131065219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).