C8H16FN3O — CID 131065223
1-(2-fluoroethyl)-3-(1-methylpyrrolidin-3-yl)urea (PubChem CID 131065223) has the molecular formula C8H16FN3O and a molecular weight of 189.23 g/mol. Its IUPAC name is 1-(2-fluoroethyl)-3-(1-methylpyrrolidin-3-yl)urea.
| Compound Name | 1-(2-fluoroethyl)-3-(1-methylpyrrolidin-3-yl)urea |
|---|---|
| PubChem CID | 131065223 |
| Molecular Formula | C8H16FN3O |
| Molecular Weight | 189.23 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | 1-(2-fluoroethyl)-3-(1-methylpyrrolidin-3-yl)urea |
| SMILES | CN1CCC(NC(=O)NCCF)C1 |
| InChI | InChI=1S/C8H16FN3O/c1-12-5-2-7(6-12)11-8(13)10-4-3-9/h7H,2-6H2,1H3,(H2,10,11,13) |
| InChIKey | XPMIIKZMVDFRIM-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.23 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |