C12H24N2 — CID 131065558
(3R)-1-(4,4-dimethylcyclohexyl)pyrrolidin-3-amine (PubChem CID 131065558) has the molecular formula C12H24N2 and a molecular weight of 196.34 g/mol. Its IUPAC name is (3R)-1-(4,4-dimethylcyclohexyl)pyrrolidin-3-amine.
| Compound Name | (3R)-1-(4,4-dimethylcyclohexyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 131065558 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | (3R)-1-(4,4-dimethylcyclohexyl)pyrrolidin-3-amine |
| SMILES | CC1(C)CCC(N2CC[C@@H](N)C2)CC1 |
| InChI | InChI=1S/C12H24N2/c1-12(2)6-3-11(4-7-12)14-8-5-10(13)9-14/h10-11H,3-9,13H2,1-2H3/t10-/m1/s1 |
| InChIKey | ICUFONJJNHDSNJ-SNVBAGLBSA-N |
| XLogP | 1.99 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |