About pyridazin-3-yl N,N-dimethylcarbamodithioate
pyridazin-3-yl N,N-dimethylcarbamodithioate (PubChem CID 131065614) has the molecular formula C7H9N3S2
and a molecular weight of 199.30 g/mol. Its IUPAC name is pyridazin-3-yl N,N-dimethylcarbamodithioate.
Molecular Properties
| Compound Name | pyridazin-3-yl N,N-dimethylcarbamodithioate |
| PubChem CID | 131065614 |
| Molecular Formula | C7H9N3S2 |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.02 |
| IUPAC Name | pyridazin-3-yl N,N-dimethylcarbamodithioate |
| SMILES | CN(C)C(=S)Sc1cccnn1 |
| InChI | InChI=1S/C7H9N3S2/c1-10(2)7(11)12-6-4-3-5-8-9-6/h3-5H,1-2H3 |
| InChIKey | ITBDBXFWOXSTPZ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze pyridazin-3-yl N,N-dimethylcarbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridazin-3-yl N,N-dimethylcarbamodithioate?
The IUPAC name of pyridazin-3-yl N,N-dimethylcarbamodithioate (CID 131065614) is pyridazin-3-yl N,N-dimethylcarbamodithioate.
What is the SMILES notation for pyridazin-3-yl N,N-dimethylcarbamodithioate?
The canonical SMILES for pyridazin-3-yl N,N-dimethylcarbamodithioate is CN(C)C(=S)Sc1cccnn1.
What is the InChIKey of pyridazin-3-yl N,N-dimethylcarbamodithioate?
The InChIKey is ITBDBXFWOXSTPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3S2/c1-10(2)7(11)12-6-4-3-5-8-9-6/h3-5H,1-2H3.
What are the key properties of pyridazin-3-yl N,N-dimethylcarbamodithioate?
pyridazin-3-yl N,N-dimethylcarbamodithioate has a molecular weight of 199.30 g/mol, XLogP of 1.42, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyridazin-3-yl N,N-dimethylcarbamodithioate is sourced from PubChem (CID 131065614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).