About N-[3-(1,3-thiazol-2-yl)pyrrolidin-3-yl]acetamide;hydrochloride
N-[3-(1,3-thiazol-2-yl)pyrrolidin-3-yl]acetamide;hydrochloride (PubChem CID 131065818) has the molecular formula C9H14ClN3OS
and a molecular weight of 247.75 g/mol. Its IUPAC name is N-[3-(1,3-thiazol-2-yl)pyrrolidin-3-yl]acetamide;hydrochloride.
Molecular Properties
| Compound Name | N-[3-(1,3-thiazol-2-yl)pyrrolidin-3-yl]acetamide;hydrochloride |
| PubChem CID | 131065818 |
| Molecular Formula | C9H14ClN3OS |
| Molecular Weight | 247.75 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | N-[3-(1,3-thiazol-2-yl)pyrrolidin-3-yl]acetamide;hydrochloride |
| SMILES | CC(=O)NC1(c2nccs2)CCNC1.Cl |
| InChI | InChI=1S/C9H13N3OS.ClH/c1-7(13)12-9(2-3-10-6-9)8-11-4-5-14-8;/h4-5,10H,2-3,6H2,1H3,(H,12,13);1H |
| InChIKey | KLSRGYRJAUXZST-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.75 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[3-(1,3-thiazol-2-yl)pyrrolidin-3-yl]acetamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(1,3-thiazol-2-yl)pyrrolidin-3-yl]acetamide;hydrochloride?
The IUPAC name of N-[3-(1,3-thiazol-2-yl)pyrrolidin-3-yl]acetamide;hydrochloride (CID 131065818) is N-[3-(1,3-thiazol-2-yl)pyrrolidin-3-yl]acetamide;hydrochloride.
What is the SMILES notation for N-[3-(1,3-thiazol-2-yl)pyrrolidin-3-yl]acetamide;hydrochloride?
The canonical SMILES for N-[3-(1,3-thiazol-2-yl)pyrrolidin-3-yl]acetamide;hydrochloride is CC(=O)NC1(c2nccs2)CCNC1.Cl.
What is the InChIKey of N-[3-(1,3-thiazol-2-yl)pyrrolidin-3-yl]acetamide;hydrochloride?
The InChIKey is KLSRGYRJAUXZST-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3OS.ClH/c1-7(13)12-9(2-3-10-6-9)8-11-4-5-14-8;/h4-5,10H,2-3,6H2,1H3,(H,12,13);1H.
What are the key properties of N-[3-(1,3-thiazol-2-yl)pyrrolidin-3-yl]acetamide;hydrochloride?
N-[3-(1,3-thiazol-2-yl)pyrrolidin-3-yl]acetamide;hydrochloride has a molecular weight of 247.75 g/mol, XLogP of 0.89, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(1,3-thiazol-2-yl)pyrrolidin-3-yl]acetamide;hydrochloride is sourced from PubChem (CID 131065818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).