About N-cyclopropyl-N-methyl-3,4-dihydro-2H-pyran-2-carboxamide
N-cyclopropyl-N-methyl-3,4-dihydro-2H-pyran-2-carboxamide (PubChem CID 131067235) has the molecular formula C10H15NO2
and a molecular weight of 181.23 g/mol. Its IUPAC name is N-cyclopropyl-N-methyl-3,4-dihydro-2H-pyran-2-carboxamide.
Molecular Properties
| Compound Name | N-cyclopropyl-N-methyl-3,4-dihydro-2H-pyran-2-carboxamide |
| PubChem CID | 131067235 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | N-cyclopropyl-N-methyl-3,4-dihydro-2H-pyran-2-carboxamide |
| SMILES | CN(C(=O)C1CCC=CO1)C1CC1 |
| InChI | InChI=1S/C10H15NO2/c1-11(8-5-6-8)10(12)9-4-2-3-7-13-9/h3,7-9H,2,4-6H2,1H3 |
| InChIKey | NTFQHQFDHZWSHR-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-cyclopropyl-N-methyl-3,4-dihydro-2H-pyran-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-N-methyl-3,4-dihydro-2H-pyran-2-carboxamide?
The IUPAC name of N-cyclopropyl-N-methyl-3,4-dihydro-2H-pyran-2-carboxamide (CID 131067235) is N-cyclopropyl-N-methyl-3,4-dihydro-2H-pyran-2-carboxamide.
What is the SMILES notation for N-cyclopropyl-N-methyl-3,4-dihydro-2H-pyran-2-carboxamide?
The canonical SMILES for N-cyclopropyl-N-methyl-3,4-dihydro-2H-pyran-2-carboxamide is CN(C(=O)C1CCC=CO1)C1CC1.
What is the InChIKey of N-cyclopropyl-N-methyl-3,4-dihydro-2H-pyran-2-carboxamide?
The InChIKey is NTFQHQFDHZWSHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO2/c1-11(8-5-6-8)10(12)9-4-2-3-7-13-9/h3,7-9H,2,4-6H2,1H3.
What are the key properties of N-cyclopropyl-N-methyl-3,4-dihydro-2H-pyran-2-carboxamide?
N-cyclopropyl-N-methyl-3,4-dihydro-2H-pyran-2-carboxamide has a molecular weight of 181.23 g/mol, XLogP of 1.30, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-N-methyl-3,4-dihydro-2H-pyran-2-carboxamide is sourced from PubChem (CID 131067235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).