About 1,3-dimethyl-5-N-(1-methylazetidin-3-yl)pyrazole-4,5-diamine
1,3-dimethyl-5-N-(1-methylazetidin-3-yl)pyrazole-4,5-diamine (PubChem CID 131067725) has the molecular formula C9H17N5
and a molecular weight of 195.27 g/mol. Its IUPAC name is 1,3-dimethyl-5-N-(1-methylazetidin-3-yl)pyrazole-4,5-diamine.
Molecular Properties
| Compound Name | 1,3-dimethyl-5-N-(1-methylazetidin-3-yl)pyrazole-4,5-diamine |
| PubChem CID | 131067725 |
| Molecular Formula | C9H17N5 |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.15 |
| IUPAC Name | 1,3-dimethyl-5-N-(1-methylazetidin-3-yl)pyrazole-4,5-diamine |
| SMILES | Cc1nn(C)c(NC2CN(C)C2)c1N |
| InChI | InChI=1S/C9H17N5/c1-6-8(10)9(14(3)12-6)11-7-4-13(2)5-7/h7,11H,4-5,10H2,1-3H3 |
| InChIKey | OGKHDAOSMSLBGL-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 59.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1,3-dimethyl-5-N-(1-methylazetidin-3-yl)pyrazole-4,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-5-N-(1-methylazetidin-3-yl)pyrazole-4,5-diamine?
The IUPAC name of 1,3-dimethyl-5-N-(1-methylazetidin-3-yl)pyrazole-4,5-diamine (CID 131067725) is 1,3-dimethyl-5-N-(1-methylazetidin-3-yl)pyrazole-4,5-diamine.
What is the SMILES notation for 1,3-dimethyl-5-N-(1-methylazetidin-3-yl)pyrazole-4,5-diamine?
The canonical SMILES for 1,3-dimethyl-5-N-(1-methylazetidin-3-yl)pyrazole-4,5-diamine is Cc1nn(C)c(NC2CN(C)C2)c1N.
What is the InChIKey of 1,3-dimethyl-5-N-(1-methylazetidin-3-yl)pyrazole-4,5-diamine?
The InChIKey is OGKHDAOSMSLBGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N5/c1-6-8(10)9(14(3)12-6)11-7-4-13(2)5-7/h7,11H,4-5,10H2,1-3H3.
What are the key properties of 1,3-dimethyl-5-N-(1-methylazetidin-3-yl)pyrazole-4,5-diamine?
1,3-dimethyl-5-N-(1-methylazetidin-3-yl)pyrazole-4,5-diamine has a molecular weight of 195.27 g/mol, XLogP of 0.04, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-5-N-(1-methylazetidin-3-yl)pyrazole-4,5-diamine is sourced from PubChem (CID 131067725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).