About N-(1-fluoropropan-2-yl)tetrazolo[1,5-a]pyrazin-8-amine
N-(1-fluoropropan-2-yl)tetrazolo[1,5-a]pyrazin-8-amine (PubChem CID 131070813) has the molecular formula C7H9FN6
and a molecular weight of 196.19 g/mol. Its IUPAC name is N-(1-fluoropropan-2-yl)tetrazolo[1,5-a]pyrazin-8-amine.
Molecular Properties
| Compound Name | N-(1-fluoropropan-2-yl)tetrazolo[1,5-a]pyrazin-8-amine |
| PubChem CID | 131070813 |
| Molecular Formula | C7H9FN6 |
| Molecular Weight | 196.19 g/mol |
| Exact Mass | 196.09 |
| IUPAC Name | N-(1-fluoropropan-2-yl)tetrazolo[1,5-a]pyrazin-8-amine |
| SMILES | CC(CF)Nc1nccn2nnnc12 |
| InChI | InChI=1S/C7H9FN6/c1-5(4-8)10-6-7-11-12-13-14(7)3-2-9-6/h2-3,5H,4H2,1H3,(H,9,10) |
| InChIKey | MVMHNQLFTFJPEQ-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 68.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.19 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(1-fluoropropan-2-yl)tetrazolo[1,5-a]pyrazin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-fluoropropan-2-yl)tetrazolo[1,5-a]pyrazin-8-amine?
The IUPAC name of N-(1-fluoropropan-2-yl)tetrazolo[1,5-a]pyrazin-8-amine (CID 131070813) is N-(1-fluoropropan-2-yl)tetrazolo[1,5-a]pyrazin-8-amine.
What is the SMILES notation for N-(1-fluoropropan-2-yl)tetrazolo[1,5-a]pyrazin-8-amine?
The canonical SMILES for N-(1-fluoropropan-2-yl)tetrazolo[1,5-a]pyrazin-8-amine is CC(CF)Nc1nccn2nnnc12.
What is the InChIKey of N-(1-fluoropropan-2-yl)tetrazolo[1,5-a]pyrazin-8-amine?
The InChIKey is MVMHNQLFTFJPEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9FN6/c1-5(4-8)10-6-7-11-12-13-14(7)3-2-9-6/h2-3,5H,4H2,1H3,(H,9,10).
What are the key properties of N-(1-fluoropropan-2-yl)tetrazolo[1,5-a]pyrazin-8-amine?
N-(1-fluoropropan-2-yl)tetrazolo[1,5-a]pyrazin-8-amine has a molecular weight of 196.19 g/mol, XLogP of 0.29, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-fluoropropan-2-yl)tetrazolo[1,5-a]pyrazin-8-amine is sourced from PubChem (CID 131070813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).