C9H14N2OS — CID 131071479
azetidin-3-yl-(5-ethyl-1,3-thiazol-2-yl)methanol (PubChem CID 131071479) has the molecular formula C9H14N2OS and a molecular weight of 198.29 g/mol. Its IUPAC name is azetidin-3-yl-(5-ethyl-1,3-thiazol-2-yl)methanol.
| Compound Name | azetidin-3-yl-(5-ethyl-1,3-thiazol-2-yl)methanol |
|---|---|
| PubChem CID | 131071479 |
| Molecular Formula | C9H14N2OS |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | azetidin-3-yl-(5-ethyl-1,3-thiazol-2-yl)methanol |
| SMILES | CCc1cnc(C(O)C2CNC2)s1 |
| InChI | InChI=1S/C9H14N2OS/c1-2-7-5-11-9(13-7)8(12)6-3-10-4-6/h5-6,8,10,12H,2-4H2,1H3 |
| InChIKey | VVIOQZLKKMIUMC-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |