About propan-2-ylsulfonyl propane-2-sulfonate
propan-2-ylsulfonyl propane-2-sulfonate (PubChem CID 13107254) has the molecular formula C6H14O5S2
and a molecular weight of 230.31 g/mol. Its IUPAC name is propan-2-ylsulfonyl propane-2-sulfonate.
Molecular Properties
| Compound Name | propan-2-ylsulfonyl propane-2-sulfonate |
| PubChem CID | 13107254 |
| Molecular Formula | C6H14O5S2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.03 |
| IUPAC Name | propan-2-ylsulfonyl propane-2-sulfonate |
| SMILES | CC(C)S(=O)(=O)OS(=O)(=O)C(C)C |
| InChI | InChI=1S/C6H14O5S2/c1-5(2)12(7,8)11-13(9,10)6(3)4/h5-6H,1-4H3 |
| InChIKey | OUAJDQWUJSRQDL-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze propan-2-ylsulfonyl propane-2-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-ylsulfonyl propane-2-sulfonate?
The IUPAC name of propan-2-ylsulfonyl propane-2-sulfonate (CID 13107254) is propan-2-ylsulfonyl propane-2-sulfonate.
What is the SMILES notation for propan-2-ylsulfonyl propane-2-sulfonate?
The canonical SMILES for propan-2-ylsulfonyl propane-2-sulfonate is CC(C)S(=O)(=O)OS(=O)(=O)C(C)C.
What is the InChIKey of propan-2-ylsulfonyl propane-2-sulfonate?
The InChIKey is OUAJDQWUJSRQDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O5S2/c1-5(2)12(7,8)11-13(9,10)6(3)4/h5-6H,1-4H3.
What are the key properties of propan-2-ylsulfonyl propane-2-sulfonate?
propan-2-ylsulfonyl propane-2-sulfonate has a molecular weight of 230.31 g/mol, XLogP of 0.48, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-ylsulfonyl propane-2-sulfonate is sourced from PubChem (CID 13107254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).